C21H13N3O7S3 — CID 86281582
2-[7-(4-nitrophenyl)sulfonyloxybenzo[g][1,3]benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 86281582) has the molecular formula C21H13N3O7S3 and a molecular weight of 515.55 g/mol. Its IUPAC name is 2-[7-(4-nitrophenyl)sulfonyloxybenzo[g][1,3]benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[7-(4-nitrophenyl)sulfonyloxybenzo[g][1,3]benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 86281582 |
| Molecular Formula | C21H13N3O7S3 |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | 2-[7-(4-nitrophenyl)sulfonyloxybenzo[g][1,3]benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2nc3ccc4cc(OS(=O)(=O)c5ccc([N+](=O)[O-])cc5)ccc4c3s2)=N1 |
| InChI | InChI=1S/C21H13N3O7S3/c25-21(26)17-10-32-19(23-17)20-22-16-8-1-11-9-13(4-7-15(11)18(16)33-20)31-34(29,30)14-5-2-12(3-6-14)24(27)28/h1-9,17H,10H2,(H,25,26) |
| InChIKey | PCOPRHXKYKLWKQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|