C23H27N5O3 — CID 87074256
(2E,4E)-5-(dimethylamino)-2-ethenyl-N-[2-methyl-3-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]phenyl]penta-2,4-dienamide (PubChem CID 87074256) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2E,4E)-5-(dimethylamino)-2-ethenyl-N-[2-methyl-3-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(dimethylamino)-2-ethenyl-N-[2-methyl-3-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87074256 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (2E,4E)-5-(dimethylamino)-2-ethenyl-N-[2-methyl-3-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]phenyl]penta-2,4-dienamide |
| SMILES | C=C/C(=C\C=C\N(C)C)C(=O)Nc1cccc(-c2c[nH]c(=O)c(NC(=O)NC)c2)c1C |
| InChI | InChI=1S/C23H27N5O3/c1-6-16(9-8-12-28(4)5)21(29)26-19-11-7-10-18(15(19)2)17-13-20(22(30)25-14-17)27-23(31)24-3/h6-14H,1H2,2-5H3,(H,25,30)(H,26,29)(H2,24,27,31)/b12-8+,16-9+ |
| InChIKey | OLTPZANZORDAMO-IGXSASHASA-N |
| XLogP | 3.23 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|