About 2-methylpropyl 2,5-dibromobenzenesulfonate
2-methylpropyl 2,5-dibromobenzenesulfonate (PubChem CID 87077272) has the molecular formula C10H12Br2O3S
and a molecular weight of 372.08 g/mol. Its IUPAC name is 2-methylpropyl 2,5-dibromobenzenesulfonate.
Molecular Properties
| Compound Name | 2-methylpropyl 2,5-dibromobenzenesulfonate |
| PubChem CID | 87077272 |
| Molecular Formula | C10H12Br2O3S |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.89 |
| IUPAC Name | 2-methylpropyl 2,5-dibromobenzenesulfonate |
| SMILES | CC(C)COS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H12Br2O3S/c1-7(2)6-15-16(13,14)10-5-8(11)3-4-9(10)12/h3-5,7H,6H2,1-2H3 |
| InChIKey | ANJCZPNRSXFUDS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2,5-dibromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2,5-dibromobenzenesulfonate?
The IUPAC name of 2-methylpropyl 2,5-dibromobenzenesulfonate (CID 87077272) is 2-methylpropyl 2,5-dibromobenzenesulfonate.
What is the SMILES notation for 2-methylpropyl 2,5-dibromobenzenesulfonate?
The canonical SMILES for 2-methylpropyl 2,5-dibromobenzenesulfonate is CC(C)COS(=O)(=O)c1cc(Br)ccc1Br.
What is the InChIKey of 2-methylpropyl 2,5-dibromobenzenesulfonate?
The InChIKey is ANJCZPNRSXFUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br2O3S/c1-7(2)6-15-16(13,14)10-5-8(11)3-4-9(10)12/h3-5,7H,6H2,1-2H3.
What are the key properties of 2-methylpropyl 2,5-dibromobenzenesulfonate?
2-methylpropyl 2,5-dibromobenzenesulfonate has a molecular weight of 372.08 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2,5-dibromobenzenesulfonate is sourced from PubChem (CID 87077272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).