C10H12Br2O3S — CID 87077272
2-methylpropyl 2,5-dibromobenzenesulfonate (PubChem CID 87077272) has the molecular formula C10H12Br2O3S and a molecular weight of 372.08 g/mol. Its IUPAC name is 2-methylpropyl 2,5-dibromobenzenesulfonate.
| Compound Name | 2-methylpropyl 2,5-dibromobenzenesulfonate |
|---|---|
| PubChem CID | 87077272 |
| Molecular Formula | C10H12Br2O3S |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.89 |
| IUPAC Name | 2-methylpropyl 2,5-dibromobenzenesulfonate |
| SMILES | CC(C)COS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H12Br2O3S/c1-7(2)6-15-16(13,14)10-5-8(11)3-4-9(10)12/h3-5,7H,6H2,1-2H3 |
| InChIKey | ANJCZPNRSXFUDS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|