C20H24N3O2+ — CID 8709837
N-[(1S)-1,2-diphenylethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide (PubChem CID 8709837) has the molecular formula C20H24N3O2+ and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[(1S)-1,2-diphenylethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[(1S)-1,2-diphenylethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8709837 |
| Molecular Formula | C20H24N3O2+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-[(1S)-1,2-diphenylethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C1C[NH+](CC(=O)N[C@@H](Cc2ccccc2)c2ccccc2)CCN1 |
| InChI | InChI=1S/C20H23N3O2/c24-19-14-23(12-11-21-19)15-20(25)22-18(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,21,24)(H,22,25)/p+1/t18-/m0/s1 |
| InChIKey | XGIMBBDZOQKQMO-SFHVURJKSA-O |
| XLogP | 0.10 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |