C17H16F3IN2O3S — CID 87100810
N-[6-ethoxy-3,4-difluoro-2-(4-fluoro-2-iodoanilino)phenyl]cyclopropanesulfonamide (PubChem CID 87100810) has the molecular formula C17H16F3IN2O3S and a molecular weight of 512.29 g/mol. Its IUPAC name is N-[6-ethoxy-3,4-difluoro-2-(4-fluoro-2-iodoanilino)phenyl]cyclopropanesulfonamide.
| Compound Name | N-[6-ethoxy-3,4-difluoro-2-(4-fluoro-2-iodoanilino)phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 87100810 |
| Molecular Formula | C17H16F3IN2O3S |
| Molecular Weight | 512.29 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | N-[6-ethoxy-3,4-difluoro-2-(4-fluoro-2-iodoanilino)phenyl]cyclopropanesulfonamide |
| SMILES | CCOc1cc(F)c(F)c(Nc2ccc(F)cc2I)c1NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C17H16F3IN2O3S/c1-2-26-14-8-11(19)15(20)17(16(14)23-27(24,25)10-4-5-10)22-13-6-3-9(18)7-12(13)21/h3,6-8,10,22-23H,2,4-5H2,1H3 |
| InChIKey | KPUFBHNWKRJCPC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|