About tetrakis(3-methylbutyl)-λ4-sulfane
tetrakis(3-methylbutyl)-λ4-sulfane (PubChem CID 87113718) has the molecular formula C20H44S
and a molecular weight of 316.64 g/mol. Its IUPAC name is tetrakis(3-methylbutyl)-λ4-sulfane.
Molecular Properties
| Compound Name | tetrakis(3-methylbutyl)-λ4-sulfane |
| PubChem CID | 87113718 |
| Molecular Formula | C20H44S |
| Molecular Weight | 316.64 g/mol |
| Exact Mass | 316.32 |
| IUPAC Name | tetrakis(3-methylbutyl)-λ4-sulfane |
| SMILES | CC(C)CCS(CCC(C)C)(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C20H44S/c1-17(2)9-13-21(14-10-18(3)4,15-11-19(5)6)16-12-20(7)8/h17-20H,9-16H2,1-8H3 |
| InChIKey | YCPXORIMRVTJRR-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetrakis(3-methylbutyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(3-methylbutyl)-λ4-sulfane?
The IUPAC name of tetrakis(3-methylbutyl)-λ4-sulfane (CID 87113718) is tetrakis(3-methylbutyl)-λ4-sulfane.
What is the SMILES notation for tetrakis(3-methylbutyl)-λ4-sulfane?
The canonical SMILES for tetrakis(3-methylbutyl)-λ4-sulfane is CC(C)CCS(CCC(C)C)(CCC(C)C)CCC(C)C.
What is the InChIKey of tetrakis(3-methylbutyl)-λ4-sulfane?
The InChIKey is YCPXORIMRVTJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44S/c1-17(2)9-13-21(14-10-18(3)4,15-11-19(5)6)16-12-20(7)8/h17-20H,9-16H2,1-8H3.
What are the key properties of tetrakis(3-methylbutyl)-λ4-sulfane?
tetrakis(3-methylbutyl)-λ4-sulfane has a molecular weight of 316.64 g/mol, XLogP of 6.98, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(3-methylbutyl)-λ4-sulfane is sourced from PubChem (CID 87113718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).