C10H22O4S2 — CID 88519722
1-(2,2-dimethylpropylsulfonylsulfonyl)-3-methylbutane (PubChem CID 88519722) has the molecular formula C10H22O4S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfonylsulfonyl)-3-methylbutane.
| Compound Name | 1-(2,2-dimethylpropylsulfonylsulfonyl)-3-methylbutane |
|---|---|
| PubChem CID | 88519722 |
| Molecular Formula | C10H22O4S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfonylsulfonyl)-3-methylbutane |
| SMILES | CC(C)CCS(=O)(=O)S(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H22O4S2/c1-9(2)6-7-15(11,12)16(13,14)8-10(3,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | AWIFMHGZUDQQOQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|