C30H55NO11 — CID 87132608
[9-(acetylperoxymethyl)-3-ethyl-8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl] 3-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]propanoate (PubChem CID 87132608) has the molecular formula C30H55NO11 and a molecular weight of 605.77 g/mol. Its IUPAC name is [9-(acetylperoxymethyl)-3-ethyl-8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl] 3-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | [9-(acetylperoxymethyl)-3-ethyl-8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl] 3-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 87132608 |
| Molecular Formula | C30H55NO11 |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 605.38 |
| IUPAC Name | [9-(acetylperoxymethyl)-3-ethyl-8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl] 3-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]propanoate |
| SMILES | CCCCOCCOCCOCCOCCC(=O)OC1(CC)COC2(CC(C)(C)N(COOC(C)=O)C(C)(C)C2)OC1 |
| InChI | InChI=1S/C30H55NO11/c1-8-10-12-34-14-16-36-18-19-37-17-15-35-13-11-26(33)41-29(9-2)22-38-30(39-23-29)20-27(4,5)31(28(6,7)21-30)24-40-42-25(3)32/h8-24H2,1-7H3 |
| InChIKey | LXNROTFMAGMJOM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 120.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|