C14H28N2O6 — CID 87134522
2-methyl-N-[3-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]prop-2-enamide (PubChem CID 87134522) has the molecular formula C14H28N2O6 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-methyl-N-[3-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 87134522 |
| Molecular Formula | C14H28N2O6 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-methyl-N-[3-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCN(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H28N2O6/c1-9(2)14(22)15-5-4-6-16(3)7-10(18)12(20)13(21)11(19)8-17/h10-13,17-21H,1,4-8H2,2-3H3,(H,15,22)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | ZIHWMERXAXJWLY-UMSGYPCISA-N |
| XLogP | -2.56 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|