C6H11NaO9S — CID 87134639
sodium [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] sulfate (PubChem CID 87134639) has the molecular formula C6H11NaO9S and a molecular weight of 282.20 g/mol. Its IUPAC name is sodium [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] sulfate.
| Compound Name | sodium [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] sulfate |
|---|---|
| PubChem CID | 87134639 |
| Molecular Formula | C6H11NaO9S |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | sodium [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] sulfate |
| SMILES | O=C(COS(=O)(=O)[O-])[C@H](O)[C@@H](O)[C@H](O)CO.[Na+] |
| InChI | InChI=1S/C6H12O9S.Na/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;/h3,5-8,10-11H,1-2H2,(H,12,13,14);/q;+1/p-1/t3-,5+,6+;/m1./s1 |
| InChIKey | XXRFTOMNBXCSPG-QEQRQOETSA-M |
| XLogP | -6.89 |
| TPSA | 164.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | -6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|