C6H12Na2O11S2 — CID 173193420
CID 173193420 (PubChem CID 173193420) has the molecular formula C6H12Na2O11S2 and a molecular weight of 370.27 g/mol.
| Compound Name | CID 173193420 |
|---|---|
| PubChem CID | 173193420 |
| Molecular Formula | C6H12Na2O11S2 |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | — |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO.O=S([O-])S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H12O6.2Na.H2O5S2/c7-1-3(9)5(11)6(12)4(10)2-8;;;1-6(2)7(3,4)5/h3,5-9,11-12H,1-2H2;;;(H,1,2)(H,3,4,5)/q;2*+1;/p-2/t3-,5-,6-;;;/m1.../s1 |
| InChIKey | LFDQLMZEPGZXPK-PWVOXRODSA-L |
| XLogP | -11.04 |
| TPSA | 215.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | -11.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|