C3H6O7P2 — CID 87141403
CID 87141403 (PubChem CID 87141403) has the molecular formula C3H6O7P2 and a molecular weight of 216.02 g/mol.
| Compound Name | CID 87141403 |
|---|---|
| PubChem CID | 87141403 |
| Molecular Formula | C3H6O7P2 |
| Molecular Weight | 216.02 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | — |
| SMILES | O=P(=O)OCC(CO)OP(=O)=O |
| InChI | InChI=1S/C3H6O7P2/c4-1-3(10-12(7)8)2-9-11(5)6/h3-4H,1-2H2 |
| InChIKey | IBVCFSOPXQZOTN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.02 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|