C33H58BClN6Ni — CID 87146729
nickel;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride (PubChem CID 87146729) has the molecular formula C33H58BClN6Ni and a molecular weight of 643.83 g/mol. Its IUPAC name is nickel;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride.
| Compound Name | nickel;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride |
|---|---|
| PubChem CID | 87146729 |
| Molecular Formula | C33H58BClN6Ni |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | nickel;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride |
| SMILES | CC(C)(C)c1n[nH]c(C(C)(C)C)c1B(c1c(C(C)(C)C)n[nH]c1C(C)(C)C)c1c(C(C)(C)C)n[nH]c1C(C)(C)C.Cl.[Ni] |
| InChI | InChI=1S/C33H57BN6.ClH.Ni/c1-28(2,3)22-19(23(36-35-22)29(4,5)6)34(20-24(30(7,8)9)37-38-25(20)31(10,11)12)21-26(32(13,14)15)39-40-27(21)33(16,17)18;;/h1-18H3,(H,35,36)(H,37,38)(H,39,40);1H; |
| InChIKey | CJVDIDLOYRZHEN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|