About 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol
2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol (PubChem CID 87149692) has the molecular formula C6H15NO3
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol |
| PubChem CID | 87149692 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol |
| SMILES | NCC(CO)C(CO)CO |
| InChI | InChI=1S/C6H15NO3/c7-1-5(2-8)6(3-9)4-10/h5-6,8-10H,1-4,7H2 |
| InChIKey | KMKQEDLRCJAOCS-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol?
The IUPAC name of 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol (CID 87149692) is 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol.
What is the SMILES notation for 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol?
The canonical SMILES for 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol is NCC(CO)C(CO)CO.
What is the InChIKey of 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol?
The InChIKey is KMKQEDLRCJAOCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3/c7-1-5(2-8)6(3-9)4-10/h5-6,8-10H,1-4,7H2.
What are the key properties of 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol?
2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol has a molecular weight of 149.19 g/mol, XLogP of -1.85, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol is sourced from PubChem (CID 87149692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).