C6H15NO3 — CID 87149692
2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol (PubChem CID 87149692) has the molecular formula C6H15NO3 and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol.
| Compound Name | 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol |
|---|---|
| PubChem CID | 87149692 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | 2-(aminomethyl)-3-(hydroxymethyl)butane-1,4-diol |
| SMILES | NCC(CO)C(CO)CO |
| InChI | InChI=1S/C6H15NO3/c7-1-5(2-8)6(3-9)4-10/h5-6,8-10H,1-4,7H2 |
| InChIKey | KMKQEDLRCJAOCS-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |