C18H35BN4O5 — CID 87153265
CID 87153265 (PubChem CID 87153265) has the molecular formula C18H35BN4O5 and a molecular weight of 398.31 g/mol.
| Compound Name | CID 87153265 |
|---|---|
| PubChem CID | 87153265 |
| Molecular Formula | C18H35BN4O5 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)C(OC)[C@@H]1OCC(=O)NCCNCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H35BN4O5/c1-22-8-10-23(11-9-22)7-6-20-4-5-21-15(24)13-27-17-16(26-3)14(12-25-2)28-18(17)19/h14,16-18,20H,4-13H2,1-3H3,(H,21,24)/t14-,16?,17+,18-/m1/s1 |
| InChIKey | ZAQFIHUROQLKOR-HMONXNITSA-N |
| XLogP | -2.12 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|