C6H9F3O2P+ — CID 87155593
hydroxy-oxo-(5,5,5-trifluoro-3-methylpent-1-en-2-yl)phosphanium (PubChem CID 87155593) has the molecular formula C6H9F3O2P+ and a molecular weight of 201.10 g/mol. Its IUPAC name is hydroxy-oxo-(5,5,5-trifluoro-3-methylpent-1-en-2-yl)phosphanium.
| Compound Name | hydroxy-oxo-(5,5,5-trifluoro-3-methylpent-1-en-2-yl)phosphanium |
|---|---|
| PubChem CID | 87155593 |
| Molecular Formula | C6H9F3O2P+ |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | hydroxy-oxo-(5,5,5-trifluoro-3-methylpent-1-en-2-yl)phosphanium |
| SMILES | C=C(C(C)CC(F)(F)F)[P+](=O)O |
| InChI | InChI=1S/C6H8F3O2P/c1-4(3-6(7,8)9)5(2)12(10)11/h4H,2-3H2,1H3/p+1 |
| InChIKey | SCIMYZPVUDCIGY-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|