C14H21ClNO5P — CID 87156037
chloro-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]propanoyl]oxyphosphinic acid (PubChem CID 87156037) has the molecular formula C14H21ClNO5P and a molecular weight of 349.75 g/mol. Its IUPAC name is chloro-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]propanoyl]oxyphosphinic acid.
| Compound Name | chloro-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]propanoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 87156037 |
| Molecular Formula | C14H21ClNO5P |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | chloro-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]propanoyl]oxyphosphinic acid |
| SMILES | C[C@@H](C(=O)OP(=O)(O)Cl)N(OCC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H21ClNO5P/c1-11(13(17)21-22(15,18)19)16(20-10-14(2,3)4)12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | VSYVSDHBAPYPBK-NSHDSACASA-N |
| XLogP | 3.74 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|