2-(1,2-diformyloxyethylamino)butanedioic acid

C8H11NO8 — CID 87160000

IUPAC2-(1,2-diformyloxyethylamino)butanedioic acid
SMILESO=COCC(NC(CC(=O)O)C(=O)O)OC=O
InChIInChI=1S/C8H11NO8/c10-3-16-2-6(17-4-11)9-5(8(14)15)1-7(12)13/h3-6,9H,1-2H2,(H,12,13)(H,14,15)
InChIKeyQAVGLTKAJJBNKL-UHFFFAOYSA-N
MW249.17 g/mol
LogP-1.82
Rot. Bonds10

About 2-(1,2-diformyloxyethylamino)butanedioic acid

2-(1,2-diformyloxyethylamino)butanedioic acid (PubChem CID 87160000) has the molecular formula C8H11NO8 and a molecular weight of 249.17 g/mol. Its IUPAC name is 2-(1,2-diformyloxyethylamino)butanedioic acid.

Molecular Properties

Compound Name2-(1,2-diformyloxyethylamino)butanedioic acid
PubChem CID87160000
Molecular FormulaC8H11NO8
Molecular Weight249.17 g/mol
Exact Mass249.05
IUPAC Name2-(1,2-diformyloxyethylamino)butanedioic acid
SMILESO=COCC(NC(CC(=O)O)C(=O)O)OC=O
InChIInChI=1S/C8H11NO8/c10-3-16-2-6(17-4-11)9-5(8(14)15)1-7(12)13/h3-6,9H,1-2H2,(H,12,13)(H,14,15)
InChIKeyQAVGLTKAJJBNKL-UHFFFAOYSA-N
XLogP-1.82
TPSA139.23 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds10
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.17
LogP ≤ 5-1.82
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-(1,2-diformyloxyethylamino)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-diformyloxyethylamino)butanedioic acid?
The IUPAC name of 2-(1,2-diformyloxyethylamino)butanedioic acid (CID 87160000) is 2-(1,2-diformyloxyethylamino)butanedioic acid.
What is the SMILES notation for 2-(1,2-diformyloxyethylamino)butanedioic acid?
The canonical SMILES for 2-(1,2-diformyloxyethylamino)butanedioic acid is O=COCC(NC(CC(=O)O)C(=O)O)OC=O.
What is the InChIKey of 2-(1,2-diformyloxyethylamino)butanedioic acid?
The InChIKey is QAVGLTKAJJBNKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO8/c10-3-16-2-6(17-4-11)9-5(8(14)15)1-7(12)13/h3-6,9H,1-2H2,(H,12,13)(H,14,15).
What are the key properties of 2-(1,2-diformyloxyethylamino)butanedioic acid?
2-(1,2-diformyloxyethylamino)butanedioic acid has a molecular weight of 249.17 g/mol, XLogP of -1.82, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-diformyloxyethylamino)butanedioic acid is sourced from PubChem (CID 87160000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).