C8H11NO8 — CID 87160000
2-(1,2-diformyloxyethylamino)butanedioic acid (PubChem CID 87160000) has the molecular formula C8H11NO8 and a molecular weight of 249.17 g/mol. Its IUPAC name is 2-(1,2-diformyloxyethylamino)butanedioic acid.
| Compound Name | 2-(1,2-diformyloxyethylamino)butanedioic acid |
|---|---|
| PubChem CID | 87160000 |
| Molecular Formula | C8H11NO8 |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-(1,2-diformyloxyethylamino)butanedioic acid |
| SMILES | O=COCC(NC(CC(=O)O)C(=O)O)OC=O |
| InChI | InChI=1S/C8H11NO8/c10-3-16-2-6(17-4-11)9-5(8(14)15)1-7(12)13/h3-6,9H,1-2H2,(H,12,13)(H,14,15) |
| InChIKey | QAVGLTKAJJBNKL-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|