C5H7NO5 — CID 141002052
(2S)-2-(deuteriocarbonylamino)butanedioic acid (PubChem CID 141002052) has the molecular formula C5H7NO5 and a molecular weight of 162.12 g/mol. Its IUPAC name is (2S)-2-(deuteriocarbonylamino)butanedioic acid.
| Compound Name | (2S)-2-(deuteriocarbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 141002052 |
| Molecular Formula | C5H7NO5 |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | (2S)-2-(deuteriocarbonylamino)butanedioic acid |
| SMILES | [2H]C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H7NO5/c7-2-6-3(5(10)11)1-4(8)9/h2-3H,1H2,(H,6,7)(H,8,9)(H,10,11)/t3-/m0/s1/i2D |
| InChIKey | MQUUQXIFCBBFDP-XEWAXYEYSA-N |
| XLogP | -1.34 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|