About 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate
2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate (PubChem CID 87167636) has the molecular formula C10H18N2O6S
and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate.
Molecular Properties
| Compound Name | 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate |
| PubChem CID | 87167636 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate |
| SMILES | COCCOC(=O)/N=C(/NC(=O)OCCOC)SC |
| InChI | InChI=1S/C10H18N2O6S/c1-15-4-6-17-9(13)11-8(19-3)12-10(14)18-7-5-16-2/h4-7H2,1-3H3,(H,11,12,13,14) |
| InChIKey | NSMIUKABAYPXOC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate?
The IUPAC name of 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate (CID 87167636) is 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate.
What is the SMILES notation for 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate?
The canonical SMILES for 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate is COCCOC(=O)/N=C(/NC(=O)OCCOC)SC.
What is the InChIKey of 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate?
The InChIKey is NSMIUKABAYPXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O6S/c1-15-4-6-17-9(13)11-8(19-3)12-10(14)18-7-5-16-2/h4-7H2,1-3H3,(H,11,12,13,14).
What are the key properties of 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate?
2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate has a molecular weight of 294.33 g/mol, XLogP of 0.86, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl (NZ)-N-[(2-methoxyethoxycarbonylamino)-methylsulfanylmethylidene]carbamate is sourced from PubChem (CID 87167636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).