C25H26N2O11 — CID 87168836
6-[2-(4-ethoxycarbonyloxyphenyl)prop-2-enoyloxy]hexyl 3,5-dinitrobenzoate (PubChem CID 87168836) has the molecular formula C25H26N2O11 and a molecular weight of 530.49 g/mol. Its IUPAC name is 6-[2-(4-ethoxycarbonyloxyphenyl)prop-2-enoyloxy]hexyl 3,5-dinitrobenzoate.
| Compound Name | 6-[2-(4-ethoxycarbonyloxyphenyl)prop-2-enoyloxy]hexyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 87168836 |
| Molecular Formula | C25H26N2O11 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 6-[2-(4-ethoxycarbonyloxyphenyl)prop-2-enoyloxy]hexyl 3,5-dinitrobenzoate |
| SMILES | C=C(C(=O)OCCCCCCOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccc(OC(=O)OCC)cc1 |
| InChI | InChI=1S/C25H26N2O11/c1-3-35-25(30)38-22-10-8-18(9-11-22)17(2)23(28)36-12-6-4-5-7-13-37-24(29)19-14-20(26(31)32)16-21(15-19)27(33)34/h8-11,14-16H,2-7,12-13H2,1H3 |
| InChIKey | YFHQGCPESQMEMZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 174.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|