C16H17ClF3NO3 — CID 87177676
1-[2-[4-(3-chloropropoxy)benzoyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 87177676) has the molecular formula C16H17ClF3NO3 and a molecular weight of 363.76 g/mol. Its IUPAC name is 1-[2-[4-(3-chloropropoxy)benzoyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-[4-(3-chloropropoxy)benzoyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 87177676 |
| Molecular Formula | C16H17ClF3NO3 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[2-[4-(3-chloropropoxy)benzoyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(OCCCCl)cc1)C1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17ClF3NO3/c17-8-2-10-24-12-6-4-11(5-7-12)14(22)13-3-1-9-21(13)15(23)16(18,19)20/h4-7,13H,1-3,8-10H2 |
| InChIKey | NOGPTAHENKLTHA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|