C27H25N5O5 — CID 87189534
2-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-4-quinazolin-4-ylpiperazine-1-carbaldehyde (PubChem CID 87189534) has the molecular formula C27H25N5O5 and a molecular weight of 499.53 g/mol. Its IUPAC name is 2-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-4-quinazolin-4-ylpiperazine-1-carbaldehyde.
| Compound Name | 2-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-4-quinazolin-4-ylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 87189534 |
| Molecular Formula | C27H25N5O5 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-4-quinazolin-4-ylpiperazine-1-carbaldehyde |
| SMILES | COc1cc(C2CN(c3ncnc4ccccc34)CCN2C=O)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H25N5O5/c1-36-25-13-21(23(32(34)35)14-26(25)37-16-19-7-3-2-4-8-19)24-15-30(11-12-31(24)18-33)27-20-9-5-6-10-22(20)28-17-29-27/h2-10,13-14,17-18,24H,11-12,15-16H2,1H3 |
| InChIKey | NKGQCSIVNOZYKC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|