About 4-bromo-3,4-bis(sulfanyl)butan-1-ol
4-bromo-3,4-bis(sulfanyl)butan-1-ol (PubChem CID 87191256) has the molecular formula C4H9BrOS2
and a molecular weight of 217.15 g/mol. Its IUPAC name is 4-bromo-3,4-bis(sulfanyl)butan-1-ol.
Molecular Properties
| Compound Name | 4-bromo-3,4-bis(sulfanyl)butan-1-ol |
| PubChem CID | 87191256 |
| Molecular Formula | C4H9BrOS2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 215.93 |
| IUPAC Name | 4-bromo-3,4-bis(sulfanyl)butan-1-ol |
| SMILES | OCCC(S)C(S)Br |
| InChI | InChI=1S/C4H9BrOS2/c5-4(8)3(7)1-2-6/h3-4,6-8H,1-2H2 |
| InChIKey | VYIFUAUYXUAOCR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3,4-bis(sulfanyl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,4-bis(sulfanyl)butan-1-ol?
The IUPAC name of 4-bromo-3,4-bis(sulfanyl)butan-1-ol (CID 87191256) is 4-bromo-3,4-bis(sulfanyl)butan-1-ol.
What is the SMILES notation for 4-bromo-3,4-bis(sulfanyl)butan-1-ol?
The canonical SMILES for 4-bromo-3,4-bis(sulfanyl)butan-1-ol is OCCC(S)C(S)Br.
What is the InChIKey of 4-bromo-3,4-bis(sulfanyl)butan-1-ol?
The InChIKey is VYIFUAUYXUAOCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9BrOS2/c5-4(8)3(7)1-2-6/h3-4,6-8H,1-2H2.
What are the key properties of 4-bromo-3,4-bis(sulfanyl)butan-1-ol?
4-bromo-3,4-bis(sulfanyl)butan-1-ol has a molecular weight of 217.15 g/mol, XLogP of 1.32, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,4-bis(sulfanyl)butan-1-ol is sourced from PubChem (CID 87191256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).