C6H14O2S2 — CID 175360461
1,2-bis(sulfanyl)hexane-1,6-diol (PubChem CID 175360461) has the molecular formula C6H14O2S2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1,2-bis(sulfanyl)hexane-1,6-diol.
| Compound Name | 1,2-bis(sulfanyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 175360461 |
| Molecular Formula | C6H14O2S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 1,2-bis(sulfanyl)hexane-1,6-diol |
| SMILES | OCCCCC(S)C(O)S |
| InChI | InChI=1S/C6H14O2S2/c7-4-2-1-3-5(9)6(8)10/h5-10H,1-4H2 |
| InChIKey | QVCRZTFWKSBMTE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|