About 6-sulfanylhexane-1,5-diol
6-sulfanylhexane-1,5-diol (PubChem CID 87070594) has the molecular formula C6H14O2S
and a molecular weight of 150.24 g/mol. Its IUPAC name is 6-sulfanylhexane-1,5-diol.
Molecular Properties
| Compound Name | 6-sulfanylhexane-1,5-diol |
| PubChem CID | 87070594 |
| Molecular Formula | C6H14O2S |
| Molecular Weight | 150.24 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 6-sulfanylhexane-1,5-diol |
| SMILES | OCCCCC(O)CS |
| InChI | InChI=1S/C6H14O2S/c7-4-2-1-3-6(8)5-9/h6-9H,1-5H2 |
| InChIKey | LYFHNDJEAINTGU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanylhexane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanylhexane-1,5-diol?
The IUPAC name of 6-sulfanylhexane-1,5-diol (CID 87070594) is 6-sulfanylhexane-1,5-diol.
What is the SMILES notation for 6-sulfanylhexane-1,5-diol?
The canonical SMILES for 6-sulfanylhexane-1,5-diol is OCCCCC(O)CS.
What is the InChIKey of 6-sulfanylhexane-1,5-diol?
The InChIKey is LYFHNDJEAINTGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2S/c7-4-2-1-3-6(8)5-9/h6-9H,1-5H2.
What are the key properties of 6-sulfanylhexane-1,5-diol?
6-sulfanylhexane-1,5-diol has a molecular weight of 150.24 g/mol, XLogP of 0.44, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanylhexane-1,5-diol is sourced from PubChem (CID 87070594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).