C10H22O7S2 — CID 88802722
hexane-1,2,6-triol;bis(2-sulfanylacetic acid) (PubChem CID 88802722) has the molecular formula C10H22O7S2 and a molecular weight of 318.41 g/mol. Its IUPAC name is hexane-1,2,6-triol;bis(2-sulfanylacetic acid).
| Compound Name | hexane-1,2,6-triol;bis(2-sulfanylacetic acid) |
|---|---|
| PubChem CID | 88802722 |
| Molecular Formula | C10H22O7S2 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | hexane-1,2,6-triol;bis(2-sulfanylacetic acid) |
| SMILES | O=C(O)CS.O=C(O)CS.OCCCCC(O)CO |
| InChI | InChI=1S/C6H14O3.2C2H4O2S/c7-4-2-1-3-6(9)5-8;2*3-2(4)1-5/h6-9H,1-5H2;2*5H,1H2,(H,3,4) |
| InChIKey | QDHKMMWWUDSVTF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|