C12H26O9 — CID 87789645
hexane-1,2,6-triol;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 87789645) has the molecular formula C12H26O9 and a molecular weight of 314.33 g/mol. Its IUPAC name is hexane-1,2,6-triol;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | hexane-1,2,6-triol;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 87789645 |
| Molecular Formula | C12H26O9 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | hexane-1,2,6-triol;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)[C@H](O)[C@@H](O)[C@H](O)CO.OCCCCC(O)CO |
| InChI | InChI=1S/C6H12O6.C6H14O3/c7-1-3(9)5(11)6(12)4(10)2-8;7-4-2-1-3-6(9)5-8/h3,5-9,11-12H,1-2H2;6-9H,1-5H2/t3-,5+,6+;/m1./s1 |
| InChIKey | ZPSROENABZSMFB-QEQRQOETSA-N |
| XLogP | -3.88 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|