About 1-sulfanylpentane-1,5-diol
1-sulfanylpentane-1,5-diol (PubChem CID 57040423) has the molecular formula C5H12O2S
and a molecular weight of 136.22 g/mol. Its IUPAC name is 1-sulfanylpentane-1,5-diol.
Molecular Properties
| Compound Name | 1-sulfanylpentane-1,5-diol |
| PubChem CID | 57040423 |
| Molecular Formula | C5H12O2S |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 1-sulfanylpentane-1,5-diol |
| SMILES | OCCCCC(O)S |
| InChI | InChI=1S/C5H12O2S/c6-4-2-1-3-5(7)8/h5-8H,1-4H2 |
| InChIKey | JGQYAAABAYOIEM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanylpentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanylpentane-1,5-diol?
The IUPAC name of 1-sulfanylpentane-1,5-diol (CID 57040423) is 1-sulfanylpentane-1,5-diol.
What is the SMILES notation for 1-sulfanylpentane-1,5-diol?
The canonical SMILES for 1-sulfanylpentane-1,5-diol is OCCCCC(O)S.
What is the InChIKey of 1-sulfanylpentane-1,5-diol?
The InChIKey is JGQYAAABAYOIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2S/c6-4-2-1-3-5(7)8/h5-8H,1-4H2.
What are the key properties of 1-sulfanylpentane-1,5-diol?
1-sulfanylpentane-1,5-diol has a molecular weight of 136.22 g/mol, XLogP of 0.40, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanylpentane-1,5-diol is sourced from PubChem (CID 57040423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).