About 2,3-bis(sulfanyl)pentane-1,5-diol
2,3-bis(sulfanyl)pentane-1,5-diol (PubChem CID 57299441) has the molecular formula C5H12O2S2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)pentane-1,5-diol.
Molecular Properties
| Compound Name | 2,3-bis(sulfanyl)pentane-1,5-diol |
| PubChem CID | 57299441 |
| Molecular Formula | C5H12O2S2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 2,3-bis(sulfanyl)pentane-1,5-diol |
| SMILES | OCCC(S)C(S)CO |
| InChI | InChI=1S/C5H12O2S2/c6-2-1-4(8)5(9)3-7/h4-9H,1-3H2 |
| InChIKey | PFDAMYQCXZHOQG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(sulfanyl)pentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(sulfanyl)pentane-1,5-diol?
The IUPAC name of 2,3-bis(sulfanyl)pentane-1,5-diol (CID 57299441) is 2,3-bis(sulfanyl)pentane-1,5-diol.
What is the SMILES notation for 2,3-bis(sulfanyl)pentane-1,5-diol?
The canonical SMILES for 2,3-bis(sulfanyl)pentane-1,5-diol is OCCC(S)C(S)CO.
What is the InChIKey of 2,3-bis(sulfanyl)pentane-1,5-diol?
The InChIKey is PFDAMYQCXZHOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2S2/c6-2-1-4(8)5(9)3-7/h4-9H,1-3H2.
What are the key properties of 2,3-bis(sulfanyl)pentane-1,5-diol?
2,3-bis(sulfanyl)pentane-1,5-diol has a molecular weight of 168.28 g/mol, XLogP of -0.04, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(sulfanyl)pentane-1,5-diol is sourced from PubChem (CID 57299441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).