C17H31N3O4 — CID 87193101
tert-butyl N-[3-[6-aminohexyl(prop-2-enoyl)amino]-3-oxopropyl]carbamate (PubChem CID 87193101) has the molecular formula C17H31N3O4 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl N-[3-[6-aminohexyl(prop-2-enoyl)amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[6-aminohexyl(prop-2-enoyl)amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 87193101 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | tert-butyl N-[3-[6-aminohexyl(prop-2-enoyl)amino]-3-oxopropyl]carbamate |
| SMILES | C=CC(=O)N(CCCCCCN)C(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O4/c1-5-14(21)20(13-9-7-6-8-11-18)15(22)10-12-19-16(23)24-17(2,3)4/h5H,1,6-13,18H2,2-4H3,(H,19,23) |
| InChIKey | RWEBHGFNKWENHL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|