C13H11N5OS — CID 87198729
4-amino-6-[(2-methyl-1,3-benzothiazol-5-yl)amino]pyrimidine-5-carbaldehyde (PubChem CID 87198729) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 4-amino-6-[(2-methyl-1,3-benzothiazol-5-yl)amino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-amino-6-[(2-methyl-1,3-benzothiazol-5-yl)amino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 87198729 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-amino-6-[(2-methyl-1,3-benzothiazol-5-yl)amino]pyrimidine-5-carbaldehyde |
| SMILES | Cc1nc2cc(Nc3ncnc(N)c3C=O)ccc2s1 |
| InChI | InChI=1S/C13H11N5OS/c1-7-17-10-4-8(2-3-11(10)20-7)18-13-9(5-19)12(14)15-6-16-13/h2-6H,1H3,(H3,14,15,16,18) |
| InChIKey | YTPAECYTADLHKS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|