C14H9ClN2O — CID 87205998
2-chloro-1-phenylpyrrolo[3,2-b]pyridine-3-carbaldehyde (PubChem CID 87205998) has the molecular formula C14H9ClN2O and a molecular weight of 256.69 g/mol. Its IUPAC name is 2-chloro-1-phenylpyrrolo[3,2-b]pyridine-3-carbaldehyde.
| Compound Name | 2-chloro-1-phenylpyrrolo[3,2-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 87205998 |
| Molecular Formula | C14H9ClN2O |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-chloro-1-phenylpyrrolo[3,2-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1c(Cl)n(-c2ccccc2)c2cccnc12 |
| InChI | InChI=1S/C14H9ClN2O/c15-14-11(9-18)13-12(7-4-8-16-13)17(14)10-5-2-1-3-6-10/h1-9H |
| InChIKey | SCOHQWSQGWIMEI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|