C15H15F2NO2 — CID 87216957
(2,3-difluorophenyl) 4-prop-2-ynylpiperidine-1-carboxylate (PubChem CID 87216957) has the molecular formula C15H15F2NO2 and a molecular weight of 279.29 g/mol. Its IUPAC name is (2,3-difluorophenyl) 4-prop-2-ynylpiperidine-1-carboxylate.
| Compound Name | (2,3-difluorophenyl) 4-prop-2-ynylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87216957 |
| Molecular Formula | C15H15F2NO2 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2,3-difluorophenyl) 4-prop-2-ynylpiperidine-1-carboxylate |
| SMILES | C#CCC1CCN(C(=O)Oc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C15H15F2NO2/c1-2-4-11-7-9-18(10-8-11)15(19)20-13-6-3-5-12(16)14(13)17/h1,3,5-6,11H,4,7-10H2 |
| InChIKey | VRQAQJWPTXFIIO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|