C9H22IN3 — CID 87237998
5-(3-iodopropyl)hexane-1,1,6-triamine (PubChem CID 87237998) has the molecular formula C9H22IN3 and a molecular weight of 299.20 g/mol. Its IUPAC name is 5-(3-iodopropyl)hexane-1,1,6-triamine.
| Compound Name | 5-(3-iodopropyl)hexane-1,1,6-triamine |
|---|---|
| PubChem CID | 87237998 |
| Molecular Formula | C9H22IN3 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 5-(3-iodopropyl)hexane-1,1,6-triamine |
| SMILES | NCC(CCCI)CCCC(N)N |
| InChI | InChI=1S/C9H22IN3/c10-6-2-4-8(7-11)3-1-5-9(12)13/h8-9H,1-7,11-13H2 |
| InChIKey | MFLKBGGRDOLVNL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|