C23H30N2O5 — CID 87239681
(2S)-2-cyclohexyl-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzoyl]amino]acetic acid (PubChem CID 87239681) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzoyl]amino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 87239681 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (2S)-2-cyclohexyl-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzoyl]amino]acetic acid |
| SMILES | O=C(/C=C/c1ccc(C(=O)N[C@](C(=O)O)(C2CCCCC2)C2CCCC2)cc1)NO |
| InChI | InChI=1S/C23H30N2O5/c26-20(25-30)15-12-16-10-13-17(14-11-16)21(27)24-23(22(28)29,19-8-4-5-9-19)18-6-2-1-3-7-18/h10-15,18-19,30H,1-9H2,(H,24,27)(H,25,26)(H,28,29)/b15-12+/t23-/m1/s1 |
| InChIKey | CLBOJSGMGCALDY-MEWQITQSSA-N |
| XLogP | 3.53 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|