About 3,3-diiodocyclooctyne
3,3-diiodocyclooctyne (PubChem CID 87241329) has the molecular formula C8H10I2
and a molecular weight of 359.98 g/mol. Its IUPAC name is 3,3-diiodocyclooctyne.
Molecular Properties
| Compound Name | 3,3-diiodocyclooctyne |
| PubChem CID | 87241329 |
| Molecular Formula | C8H10I2 |
| Molecular Weight | 359.98 g/mol |
| Exact Mass | 359.89 |
| IUPAC Name | 3,3-diiodocyclooctyne |
| SMILES | IC1(I)C#CCCCCC1 |
| InChI | InChI=1S/C8H10I2/c9-8(10)6-4-2-1-3-5-7-8/h1-4,6H2 |
| InChIKey | GQJNUSGHFGUFAP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.98 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diiodocyclooctyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diiodocyclooctyne?
The IUPAC name of 3,3-diiodocyclooctyne (CID 87241329) is 3,3-diiodocyclooctyne.
What is the SMILES notation for 3,3-diiodocyclooctyne?
The canonical SMILES for 3,3-diiodocyclooctyne is IC1(I)C#CCCCCC1.
What is the InChIKey of 3,3-diiodocyclooctyne?
The InChIKey is GQJNUSGHFGUFAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10I2/c9-8(10)6-4-2-1-3-5-7-8/h1-4,6H2.
What are the key properties of 3,3-diiodocyclooctyne?
3,3-diiodocyclooctyne has a molecular weight of 359.98 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diiodocyclooctyne is sourced from PubChem (CID 87241329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).