C18H31NO6 — CID 87249906
2-(tert-butylamino)ethyl 2-methylprop-2-enoate;6-ethenoxy-6-oxohexanoic acid (PubChem CID 87249906) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-(tert-butylamino)ethyl 2-methylprop-2-enoate;6-ethenoxy-6-oxohexanoic acid.
| Compound Name | 2-(tert-butylamino)ethyl 2-methylprop-2-enoate;6-ethenoxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87249906 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-(tert-butylamino)ethyl 2-methylprop-2-enoate;6-ethenoxy-6-oxohexanoic acid |
| SMILES | C=C(C)C(=O)OCCNC(C)(C)C.C=COC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C10H19NO2.C8H12O4/c1-8(2)9(12)13-7-6-11-10(3,4)5;1-2-12-8(11)6-4-3-5-7(9)10/h11H,1,6-7H2,2-5H3;2H,1,3-6H2,(H,9,10) |
| InChIKey | CLJAAFJOYOKCCB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|