C23H23NO3S — CID 87250216
(2R)-2-[methoxy(trityl)amino]-3-sulfanylpropanoic acid (PubChem CID 87250216) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is (2R)-2-[methoxy(trityl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[methoxy(trityl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87250216 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (2R)-2-[methoxy(trityl)amino]-3-sulfanylpropanoic acid |
| SMILES | CON([C@@H](CS)C(=O)O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c1-27-24(21(17-28)22(25)26)23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,28H,17H2,1H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | GDQWQDLPDMZFIE-NRFANRHFSA-N |
| XLogP | 4.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|