C19H15F9O6S — CID 87253936
2-hydroxy-1-[2-(hydroxymethyl)phenyl]-2-phenylethanone;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 87253936) has the molecular formula C19H15F9O6S and a molecular weight of 542.37 g/mol. Its IUPAC name is 2-hydroxy-1-[2-(hydroxymethyl)phenyl]-2-phenylethanone;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 2-hydroxy-1-[2-(hydroxymethyl)phenyl]-2-phenylethanone;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 87253936 |
| Molecular Formula | C19H15F9O6S |
| Molecular Weight | 542.37 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 2-hydroxy-1-[2-(hydroxymethyl)phenyl]-2-phenylethanone;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | O=C(c1ccccc1CO)C(O)c1ccccc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14O3.C4HF9O3S/c16-10-12-8-4-5-9-13(12)15(18)14(17)11-6-2-1-3-7-11;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-9,14,16-17H,10H2;(H,14,15,16) |
| InChIKey | AGRVKBJYBHTTQM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|