C15H12N6O2S — CID 87256211
6-(3-nitrophenyl)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazoline-2,8-diamine (PubChem CID 87256211) has the molecular formula C15H12N6O2S and a molecular weight of 340.37 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazoline-2,8-diamine.
| Compound Name | 6-(3-nitrophenyl)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazoline-2,8-diamine |
|---|---|
| PubChem CID | 87256211 |
| Molecular Formula | C15H12N6O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 6-(3-nitrophenyl)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazoline-2,8-diamine |
| SMILES | Nc1nc(-c2cccc([N+](=O)[O-])c2)c2c(n1)-c1sc(N)nc1CC2 |
| InChI | InChI=1S/C15H12N6O2S/c16-14-19-11(7-2-1-3-8(6-7)21(22)23)9-4-5-10-13(12(9)20-14)24-15(17)18-10/h1-3,6H,4-5H2,(H2,17,18)(H2,16,19,20) |
| InChIKey | VSUABTWISOBAQJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|