C30H21F5N4 — CID 87256907
7,8,10,12,23-pentafluoro-2,3,5,21-tetramethyl-13-phenylporphyrin (PubChem CID 87256907) has the molecular formula C30H21F5N4 and a molecular weight of 532.52 g/mol. Its IUPAC name is 7,8,10,12,23-pentafluoro-2,3,5,21-tetramethyl-13-phenylporphyrin.
| Compound Name | 7,8,10,12,23-pentafluoro-2,3,5,21-tetramethyl-13-phenylporphyrin |
|---|---|
| PubChem CID | 87256907 |
| Molecular Formula | C30H21F5N4 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 7,8,10,12,23-pentafluoro-2,3,5,21-tetramethyl-13-phenylporphyrin |
| SMILES | Cc1c(C)c2c(C)c3nc(c(F)c4c(F)c(-c5ccccc5)c(cc5nc(cc1n2C)C=C5)n4F)C(F)=C3F |
| InChI | InChI=1S/C30H21F5N4/c1-14-15(2)29-16(3)27-24(32)25(33)28(37-27)26(34)30-23(31)22(17-8-6-5-7-9-17)21(39(30)35)13-19-11-10-18(36-19)12-20(14)38(29)4/h5-13H,1-4H3/b18-12-,19-13-,20-12-,21-13-,27-16-,28-26+,29-16-,30-26+ |
| InChIKey | HXLWZGYRPQIGBB-AOVTZHEZSA-N |
| XLogP | 8.34 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |