About 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite
2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite (PubChem CID 87262004) has the molecular formula C13H17O4P
and a molecular weight of 268.25 g/mol. Its IUPAC name is 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite |
| PubChem CID | 87262004 |
| Molecular Formula | C13H17O4P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite |
| SMILES | C=C(C)COP(OCC1CO1)Oc1ccccc1 |
| InChI | InChI=1S/C13H17O4P/c1-11(2)8-15-18(16-10-13-9-14-13)17-12-6-4-3-5-7-12/h3-7,13H,1,8-10H2,2H3 |
| InChIKey | BJNYHCKSRYYWRO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite?
The IUPAC name of 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite (CID 87262004) is 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite.
What is the SMILES notation for 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite?
The canonical SMILES for 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite is C=C(C)COP(OCC1CO1)Oc1ccccc1.
What is the InChIKey of 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite?
The InChIKey is BJNYHCKSRYYWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17O4P/c1-11(2)8-15-18(16-10-13-9-14-13)17-12-6-4-3-5-7-12/h3-7,13H,1,8-10H2,2H3.
What are the key properties of 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite?
2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite has a molecular weight of 268.25 g/mol, XLogP of 3.30, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl oxiran-2-ylmethyl phenyl phosphite is sourced from PubChem (CID 87262004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).