About 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide
5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide (PubChem CID 87262014) has the molecular formula C16H12Cl2F4N2O2
and a molecular weight of 411.18 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide.
Molecular Properties
| Compound Name | 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide |
| PubChem CID | 87262014 |
| Molecular Formula | C16H12Cl2F4N2O2 |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1cc(Nc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1F |
| InChI | InChI=1S/C16H12Cl2F4N2O2/c17-11-5-8(16(20,21)22)6-12(18)14(11)24-9-1-2-13(19)10(7-9)15(26)23-3-4-25/h1-2,5-7,24-25H,3-4H2,(H,23,26) |
| InChIKey | LEZFMENAFUAIPM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide?
The IUPAC name of 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide (CID 87262014) is 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide.
What is the SMILES notation for 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide?
The canonical SMILES for 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide is O=C(NCCO)c1cc(Nc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1F.
What is the InChIKey of 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide?
The InChIKey is LEZFMENAFUAIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2F4N2O2/c17-11-5-8(16(20,21)22)6-12(18)14(11)24-9-1-2-13(19)10(7-9)15(26)23-3-4-25/h1-2,5-7,24-25H,3-4H2,(H,23,26).
What are the key properties of 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide?
5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide has a molecular weight of 411.18 g/mol, XLogP of 4.62, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-fluoro-N-(2-hydroxyethyl)benzamide is sourced from PubChem (CID 87262014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).