C17H28N6O4 — CID 87264068
N-hydroxy-N-[2-[[(2-morpholin-2-ylpyrimidin-4-yl)amino]carbamoyl]heptyl]formamide (PubChem CID 87264068) has the molecular formula C17H28N6O4 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-hydroxy-N-[2-[[(2-morpholin-2-ylpyrimidin-4-yl)amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[2-[[(2-morpholin-2-ylpyrimidin-4-yl)amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 87264068 |
| Molecular Formula | C17H28N6O4 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-hydroxy-N-[2-[[(2-morpholin-2-ylpyrimidin-4-yl)amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1ccnc(C2CNCCO2)n1 |
| InChI | InChI=1S/C17H28N6O4/c1-2-3-4-5-13(11-23(26)12-24)17(25)22-21-15-6-7-19-16(20-15)14-10-18-8-9-27-14/h6-7,12-14,18,26H,2-5,8-11H2,1H3,(H,22,25)(H,19,20,21) |
| InChIKey | AGDFTOMXEFRFHX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|