C23H25F4NO6 — CID 87266911
tert-butyl 5-hydroxy-3-(phenylmethoxycarbonylamino)-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 87266911) has the molecular formula C23H25F4NO6 and a molecular weight of 487.45 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-3-(phenylmethoxycarbonylamino)-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 5-hydroxy-3-(phenylmethoxycarbonylamino)-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 87266911 |
| Molecular Formula | C23H25F4NO6 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | tert-butyl 5-hydroxy-3-(phenylmethoxycarbonylamino)-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)(C)OC(=O)CC(CC(O)Oc1c(F)c(F)cc(F)c1F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H25F4NO6/c1-23(2,3)34-18(30)10-14(28-22(31)32-12-13-7-5-4-6-8-13)9-17(29)33-21-19(26)15(24)11-16(25)20(21)27/h4-8,11,14,17,29H,9-10,12H2,1-3H3,(H,28,31) |
| InChIKey | QGKQMPSJSNVRFN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|