C7H11NO6 — CID 87268273
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-isocyanatohexanal (PubChem CID 87268273) has the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-isocyanatohexanal.
| Compound Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-isocyanatohexanal |
|---|---|
| PubChem CID | 87268273 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-isocyanatohexanal |
| SMILES | O=C=N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H11NO6/c9-1-4(8-3-11)6(13)7(14)5(12)2-10/h1,4-7,10,12-14H,2H2/t4-,5+,6+,7+/m0/s1 |
| InChIKey | YDJDPZKJXRLECP-BDVNFPICSA-N |
| XLogP | -3.04 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|