C25H27NO9S2 — CID 87269861
2-(2-methoxyphenyl)-4-methyl-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]benzenesulfonic acid (PubChem CID 87269861) has the molecular formula C25H27NO9S2 and a molecular weight of 549.62 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-4-methyl-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]benzenesulfonic acid.
| Compound Name | 2-(2-methoxyphenyl)-4-methyl-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 87269861 |
| Molecular Formula | C25H27NO9S2 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 2-(2-methoxyphenyl)-4-methyl-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]benzenesulfonic acid |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Nc2cc(S(=O)(=O)O)c(-c3ccccc3OC)cc2C)c(OC)c1 |
| InChI | InChI=1S/C25H27NO9S2/c1-16-12-20(18-8-6-7-9-22(18)33-3)25(37(29,30)31)15-21(16)26-36(27,28)11-10-19-23(34-4)13-17(32-2)14-24(19)35-5/h6-15,26H,1-5H3,(H,29,30,31)/b11-10+ |
| InChIKey | IMRCCMCPVOFEIC-ZHACJKMWSA-N |
| XLogP | 4.36 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|