C28H30F10O9S2 — CID 87272297
[1-[2-(4-tert-butylbenzoyl)oxy-1,1,3,3,3-pentafluoropropyl]sulfonyloxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate (PubChem CID 87272297) has the molecular formula C28H30F10O9S2 and a molecular weight of 764.65 g/mol. Its IUPAC name is [1-[2-(4-tert-butylbenzoyl)oxy-1,1,3,3,3-pentafluoropropyl]sulfonyloxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate.
| Compound Name | [1-[2-(4-tert-butylbenzoyl)oxy-1,1,3,3,3-pentafluoropropyl]sulfonyloxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 87272297 |
| Molecular Formula | C28H30F10O9S2 |
| Molecular Weight | 764.65 g/mol |
| Exact Mass | 764.12 |
| IUPAC Name | [1-[2-(4-tert-butylbenzoyl)oxy-1,1,3,3,3-pentafluoropropyl]sulfonyloxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)C(OC(=O)C23CC4CC(CC(C4)C2)C3)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H30F10O9S2/c1-23(2,3)18-6-4-17(5-7-18)19(39)45-20(25(29,30)31)27(35,36)48(41,42)47-49(43,44)28(37,38)21(26(32,33)34)46-22(40)24-11-14-8-15(12-24)10-16(9-14)13-24/h4-7,14-16,20-21H,8-13H2,1-3H3 |
| InChIKey | GRCOELXNELJNBR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |