C29H28N6O4S — CID 87275037
5-[6-[6-anilino-9-[3-(propan-2-ylamino)propyl]purin-8-yl]sulfanyl-1,3-benzodioxol-5-yl]furan-2-carbaldehyde (PubChem CID 87275037) has the molecular formula C29H28N6O4S and a molecular weight of 556.65 g/mol. Its IUPAC name is 5-[6-[6-anilino-9-[3-(propan-2-ylamino)propyl]purin-8-yl]sulfanyl-1,3-benzodioxol-5-yl]furan-2-carbaldehyde.
| Compound Name | 5-[6-[6-anilino-9-[3-(propan-2-ylamino)propyl]purin-8-yl]sulfanyl-1,3-benzodioxol-5-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 87275037 |
| Molecular Formula | C29H28N6O4S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 5-[6-[6-anilino-9-[3-(propan-2-ylamino)propyl]purin-8-yl]sulfanyl-1,3-benzodioxol-5-yl]furan-2-carbaldehyde |
| SMILES | CC(C)NCCCn1c(Sc2cc3c(cc2-c2ccc(C=O)o2)OCO3)nc2c(Nc3ccccc3)ncnc21 |
| InChI | InChI=1S/C29H28N6O4S/c1-18(2)30-11-6-12-35-28-26(27(31-16-32-28)33-19-7-4-3-5-8-19)34-29(35)40-25-14-24-23(37-17-38-24)13-21(25)22-10-9-20(15-36)39-22/h3-5,7-10,13-16,18,30H,6,11-12,17H2,1-2H3,(H,31,32,33) |
| InChIKey | FORVRWMGKSIEFJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|